C21H19FN4 — CID 69301033
5-(2-fluoro-5-pyridin-3-ylphenyl)-3-methyl-5-phenyl-4H-imidazol-2-amine (PubChem CID 69301033) has the molecular formula C21H19FN4 and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-(2-fluoro-5-pyridin-3-ylphenyl)-3-methyl-5-phenyl-4H-imidazol-2-amine.
| Compound Name | 5-(2-fluoro-5-pyridin-3-ylphenyl)-3-methyl-5-phenyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 69301033 |
| Molecular Formula | C21H19FN4 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5-(2-fluoro-5-pyridin-3-ylphenyl)-3-methyl-5-phenyl-4H-imidazol-2-amine |
| SMILES | CN1CC(c2ccccc2)(c2cc(-c3cccnc3)ccc2F)N=C1N |
| InChI | InChI=1S/C21H19FN4/c1-26-14-21(25-20(26)23,17-7-3-2-4-8-17)18-12-15(9-10-19(18)22)16-6-5-11-24-13-16/h2-13H,14H2,1H3,(H2,23,25) |
| InChIKey | ZZFSRCQTPAGIOR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |