C27H30N4O — CID 141128119
5-(3-cyclopentyl-4-methoxyphenyl)-3-methyl-5-(3-pyridin-3-ylphenyl)-4H-imidazol-2-amine (PubChem CID 141128119) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is 5-(3-cyclopentyl-4-methoxyphenyl)-3-methyl-5-(3-pyridin-3-ylphenyl)-4H-imidazol-2-amine.
| Compound Name | 5-(3-cyclopentyl-4-methoxyphenyl)-3-methyl-5-(3-pyridin-3-ylphenyl)-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 141128119 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 5-(3-cyclopentyl-4-methoxyphenyl)-3-methyl-5-(3-pyridin-3-ylphenyl)-4H-imidazol-2-amine |
| SMILES | COc1ccc(C2(c3cccc(-c4cccnc4)c3)CN(C)C(N)=N2)cc1C1CCCC1 |
| InChI | InChI=1S/C27H30N4O/c1-31-18-27(30-26(31)28,22-11-5-9-20(15-22)21-10-6-14-29-17-21)23-12-13-25(32-2)24(16-23)19-7-3-4-8-19/h5-6,9-17,19H,3-4,7-8,18H2,1-2H3,(H2,28,30) |
| InChIKey | KWUCCESLZDIQAJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |