About 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate
2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate (PubChem CID 69302546) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate |
| PubChem CID | 69302546 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate |
| SMILES | CCCCNCCOC(=O)OC1CC2C=CC1C2 |
| InChI | InChI=1S/C14H23NO3/c1-2-3-6-15-7-8-17-14(16)18-13-10-11-4-5-12(13)9-11/h4-5,11-13,15H,2-3,6-10H2,1H3 |
| InChIKey | OPKHYHBZYVIJRW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate?
The IUPAC name of 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate (CID 69302546) is 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate.
What is the SMILES notation for 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate?
The canonical SMILES for 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate is CCCCNCCOC(=O)OC1CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate?
The InChIKey is OPKHYHBZYVIJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-2-3-6-15-7-8-17-14(16)18-13-10-11-4-5-12(13)9-11/h4-5,11-13,15H,2-3,6-10H2,1H3.
What are the key properties of 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate?
2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate has a molecular weight of 253.34 g/mol, XLogP of 2.49, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hept-5-enyl 2-(butylamino)ethyl carbonate is sourced from PubChem (CID 69302546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).