C13H15F2NO3 — CID 69303286
N-[2-(2,3-difluorophenyl)ethyl]cyclopropanecarboxamide;formic acid (PubChem CID 69303286) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is N-[2-(2,3-difluorophenyl)ethyl]cyclopropanecarboxamide;formic acid.
| Compound Name | N-[2-(2,3-difluorophenyl)ethyl]cyclopropanecarboxamide;formic acid |
|---|---|
| PubChem CID | 69303286 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[2-(2,3-difluorophenyl)ethyl]cyclopropanecarboxamide;formic acid |
| SMILES | O=C(NCCc1cccc(F)c1F)C1CC1.O=CO |
| InChI | InChI=1S/C12H13F2NO.CH2O2/c13-10-3-1-2-8(11(10)14)6-7-15-12(16)9-4-5-9;2-1-3/h1-3,9H,4-7H2,(H,15,16);1H,(H,2,3) |
| InChIKey | SHFZPGZKDVPXQV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|