About 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide
3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide (PubChem CID 69303597) has the molecular formula C15H22ClN3O3
and a molecular weight of 327.81 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide.
Molecular Properties
| Compound Name | 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide |
| PubChem CID | 69303597 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide |
| SMILES | CCN1C[C@@H](NC(=O)c2cc(Cl)cc(N)c2OC)C[C@H]1CO |
| InChI | InChI=1S/C15H22ClN3O3/c1-3-19-7-10(6-11(19)8-20)18-15(21)12-4-9(16)5-13(17)14(12)22-2/h4-5,10-11,20H,3,6-8,17H2,1-2H3,(H,18,21)/t10-,11-/m0/s1 |
| InChIKey | BSMMBSOXCRUIRV-QWRGUYRKSA-N |
| XLogP | 1.12 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide?
The IUPAC name of 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide (CID 69303597) is 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide.
What is the SMILES notation for 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide?
The canonical SMILES for 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide is CCN1C[C@@H](NC(=O)c2cc(Cl)cc(N)c2OC)C[C@H]1CO.
What is the InChIKey of 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide?
The InChIKey is BSMMBSOXCRUIRV-QWRGUYRKSA-N. The full InChI is InChI=1S/C15H22ClN3O3/c1-3-19-7-10(6-11(19)8-20)18-15(21)12-4-9(16)5-13(17)14(12)22-2/h4-5,10-11,20H,3,6-8,17H2,1-2H3,(H,18,21)/t10-,11-/m0/s1.
What are the key properties of 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide?
3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide has a molecular weight of 327.81 g/mol, XLogP of 1.12, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide is sourced from PubChem (CID 69303597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).