C15H22ClN3O3 — CID 69303597
3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide (PubChem CID 69303597) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide.
| Compound Name | 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 69303597 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-amino-5-chloro-N-[(3S,5S)-1-ethyl-5-(hydroxymethyl)pyrrolidin-3-yl]-2-methoxybenzamide |
| SMILES | CCN1C[C@@H](NC(=O)c2cc(Cl)cc(N)c2OC)C[C@H]1CO |
| InChI | InChI=1S/C15H22ClN3O3/c1-3-19-7-10(6-11(19)8-20)18-15(21)12-4-9(16)5-13(17)14(12)22-2/h4-5,10-11,20H,3,6-8,17H2,1-2H3,(H,18,21)/t10-,11-/m0/s1 |
| InChIKey | BSMMBSOXCRUIRV-QWRGUYRKSA-N |
| XLogP | 1.12 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|