C35H37FO2Si2 — CID 69304704
CID 69304704 (PubChem CID 69304704) has the molecular formula C35H37FO2Si2 and a molecular weight of 564.85 g/mol.
| Compound Name | CID 69304704 |
|---|---|
| PubChem CID | 69304704 |
| Molecular Formula | C35H37FO2Si2 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | — |
| SMILES | CC(C)(Cc1ccccc1)[Si]OCC1(CO[Si]C(C)(C)Cc2ccccc2)c2ccccc2-c2ccc(F)cc21 |
| InChI | InChI=1S/C35H37FO2Si2/c1-33(2,22-26-13-7-5-8-14-26)39-37-24-35(25-38-40-34(3,4)23-27-15-9-6-10-16-27)31-18-12-11-17-29(31)30-20-19-28(36)21-32(30)35/h5-21H,22-25H2,1-4H3 |
| InChIKey | QMJMBBLXOGUYMQ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|