C27H41FO2Si2 — CID 69305459
butyl-[[9-[[butyl(dimethyl)silyl]oxymethyl]-2-fluorofluoren-9-yl]methoxy]-dimethylsilane (PubChem CID 69305459) has the molecular formula C27H41FO2Si2 and a molecular weight of 472.79 g/mol. Its IUPAC name is butyl-[[9-[[butyl(dimethyl)silyl]oxymethyl]-2-fluorofluoren-9-yl]methoxy]-dimethylsilane.
| Compound Name | butyl-[[9-[[butyl(dimethyl)silyl]oxymethyl]-2-fluorofluoren-9-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 69305459 |
| Molecular Formula | C27H41FO2Si2 |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | butyl-[[9-[[butyl(dimethyl)silyl]oxymethyl]-2-fluorofluoren-9-yl]methoxy]-dimethylsilane |
| SMILES | CCCC[Si](C)(C)OCC1(CO[Si](C)(C)CCCC)c2ccccc2-c2ccc(F)cc21 |
| InChI | InChI=1S/C27H41FO2Si2/c1-7-9-17-31(3,4)29-20-27(21-30-32(5,6)18-10-8-2)25-14-12-11-13-23(25)24-16-15-22(28)19-26(24)27/h11-16,19H,7-10,17-18,20-21H2,1-6H3 |
| InChIKey | KVIKRVNBNMEJID-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|