C18H16F4O2 — CID 22140456
2,3,6,7-tetrafluoro-9-(1-methoxyethyl)-9-(methoxymethyl)fluorene (PubChem CID 22140456) has the molecular formula C18H16F4O2 and a molecular weight of 340.32 g/mol. Its IUPAC name is 2,3,6,7-tetrafluoro-9-(1-methoxyethyl)-9-(methoxymethyl)fluorene.
| Compound Name | 2,3,6,7-tetrafluoro-9-(1-methoxyethyl)-9-(methoxymethyl)fluorene |
|---|---|
| PubChem CID | 22140456 |
| Molecular Formula | C18H16F4O2 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2,3,6,7-tetrafluoro-9-(1-methoxyethyl)-9-(methoxymethyl)fluorene |
| SMILES | COCC1(C(C)OC)c2cc(F)c(F)cc2-c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C18H16F4O2/c1-9(24-3)18(8-23-2)12-6-16(21)14(19)4-10(12)11-5-15(20)17(22)7-13(11)18/h4-7,9H,8H2,1-3H3 |
| InChIKey | CQNWWQKMMODDOL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |