C23H29N3O4S — CID 69306076
tert-butyl 4-[(5-oxido-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]piperidine-1-carboxylate (PubChem CID 69306076) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is tert-butyl 4-[(5-oxido-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-oxido-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69306076 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | tert-butyl 4-[(5-oxido-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]piperidine-1-carboxylate |
| SMILES | CCCc1nc2c[n+]([O-])c3cc(OC4CCN(C(=O)OC(C)(C)C)CC4)ccc3c2s1 |
| InChI | InChI=1S/C23H29N3O4S/c1-5-6-20-24-18-14-26(28)19-13-16(7-8-17(19)21(18)31-20)29-15-9-11-25(12-10-15)22(27)30-23(2,3)4/h7-8,13-15H,5-6,9-12H2,1-4H3 |
| InChIKey | UIHWGRMJNUBMSK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|