C27H29N7O4 — CID 69307399
2-[4-[2-[3-(2-morpholin-4-ylethyl)anilino]pyrimidin-4-yl]-3-(4-nitrophenyl)pyrazol-1-yl]ethanol (PubChem CID 69307399) has the molecular formula C27H29N7O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-[4-[2-[3-(2-morpholin-4-ylethyl)anilino]pyrimidin-4-yl]-3-(4-nitrophenyl)pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[2-[3-(2-morpholin-4-ylethyl)anilino]pyrimidin-4-yl]-3-(4-nitrophenyl)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 69307399 |
| Molecular Formula | C27H29N7O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[4-[2-[3-(2-morpholin-4-ylethyl)anilino]pyrimidin-4-yl]-3-(4-nitrophenyl)pyrazol-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(-c2nn(CCO)cc2-c2ccnc(Nc3cccc(CCN4CCOCC4)c3)n2)cc1 |
| InChI | InChI=1S/C27H29N7O4/c35-15-12-33-19-24(26(31-33)21-4-6-23(7-5-21)34(36)37)25-8-10-28-27(30-25)29-22-3-1-2-20(18-22)9-11-32-13-16-38-17-14-32/h1-8,10,18-19,35H,9,11-17H2,(H,28,29,30) |
| InChIKey | UYCXXRYZHUKQBV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|