C24H27N7O5 — CID 69311392
ethyl 4-(2-morpholin-4-ylphenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 69311392) has the molecular formula C24H27N7O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is ethyl 4-(2-morpholin-4-ylphenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(2-morpholin-4-ylphenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 69311392 |
| Molecular Formula | C24H27N7O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | ethyl 4-(2-morpholin-4-ylphenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNc2ccc([N+](=O)[O-])cn2)nc1-c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C24H27N7O5/c1-2-36-23(32)19-16-28-24(26-10-9-25-21-8-7-17(15-27-21)31(33)34)29-22(19)18-5-3-4-6-20(18)30-11-13-35-14-12-30/h3-8,15-16H,2,9-14H2,1H3,(H,25,27)(H,26,28,29) |
| InChIKey | FJCXVOSAPQBQGV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|