C11H10N3O2S- — CID 6931161
(2R)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetate (PubChem CID 6931161) has the molecular formula C11H10N3O2S- and a molecular weight of 248.29 g/mol. Its IUPAC name is (2R)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetate.
| Compound Name | (2R)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetate |
|---|---|
| PubChem CID | 6931161 |
| Molecular Formula | C11H10N3O2S- |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (2R)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetate |
| SMILES | Cn1cnnc1S[C@@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C11H11N3O2S/c1-14-7-12-13-11(14)17-9(10(15)16)8-5-3-2-4-6-8/h2-7,9H,1H3,(H,15,16)/p-1/t9-/m1/s1 |
| InChIKey | LMYXGRLHGLZUOR-SECBINFHSA-M |
| XLogP | 0.40 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |