C20H25N3O5 — CID 69311639
5-[7-ethyl-2-(methoxymethyl)-4-(3-methoxy-1,2-oxazol-5-yl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid (PubChem CID 69311639) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[7-ethyl-2-(methoxymethyl)-4-(3-methoxy-1,2-oxazol-5-yl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid.
| Compound Name | 5-[7-ethyl-2-(methoxymethyl)-4-(3-methoxy-1,2-oxazol-5-yl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 69311639 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 5-[7-ethyl-2-(methoxymethyl)-4-(3-methoxy-1,2-oxazol-5-yl)pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid |
| SMILES | CCc1ccc2c(-c3cc(OC)no3)c(CCCCC(=O)O)c(COC)nn12 |
| InChI | InChI=1S/C20H25N3O5/c1-4-13-9-10-16-20(17-11-18(27-3)22-28-17)14(7-5-6-8-19(24)25)15(12-26-2)21-23(13)16/h9-11H,4-8,12H2,1-3H3,(H,24,25) |
| InChIKey | OZEQTSWGZPCSPX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|