C24H25N3O3 — CID 69308836
5-[7-ethyl-2-methyl-4-[3-(1,3-oxazol-5-yl)phenyl]pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid (PubChem CID 69308836) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-[7-ethyl-2-methyl-4-[3-(1,3-oxazol-5-yl)phenyl]pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid.
| Compound Name | 5-[7-ethyl-2-methyl-4-[3-(1,3-oxazol-5-yl)phenyl]pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 69308836 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 5-[7-ethyl-2-methyl-4-[3-(1,3-oxazol-5-yl)phenyl]pyrrolo[1,2-b]pyridazin-3-yl]pentanoic acid |
| SMILES | CCc1ccc2c(-c3cccc(-c4cnco4)c3)c(CCCCC(=O)O)c(C)nn12 |
| InChI | InChI=1S/C24H25N3O3/c1-3-19-11-12-21-24(18-8-6-7-17(13-18)22-14-25-15-30-22)20(16(2)26-27(19)21)9-4-5-10-23(28)29/h6-8,11-15H,3-5,9-10H2,1-2H3,(H,28,29) |
| InChIKey | KSCQCNGXSXWPMU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|