C14H12N8O — CID 69312505
1-[3-(3-aminophenyl)-1,2,4-triazin-6-yl]-3-pyrazin-2-ylurea (PubChem CID 69312505) has the molecular formula C14H12N8O and a molecular weight of 308.31 g/mol. Its IUPAC name is 1-[3-(3-aminophenyl)-1,2,4-triazin-6-yl]-3-pyrazin-2-ylurea.
| Compound Name | 1-[3-(3-aminophenyl)-1,2,4-triazin-6-yl]-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 69312505 |
| Molecular Formula | C14H12N8O |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[3-(3-aminophenyl)-1,2,4-triazin-6-yl]-3-pyrazin-2-ylurea |
| SMILES | Nc1cccc(-c2ncc(NC(=O)Nc3cnccn3)nn2)c1 |
| InChI | InChI=1S/C14H12N8O/c15-10-3-1-2-9(6-10)13-18-8-12(21-22-13)20-14(23)19-11-7-16-4-5-17-11/h1-8H,15H2,(H2,17,19,20,21,23) |
| InChIKey | SQHNVNNRIAUCRK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|