C12H10N8O2 — CID 136658805
1-(3-amino-5-hydroxy-1,2,4-benzotriazin-7-yl)-3-pyrazin-2-ylurea (PubChem CID 136658805) has the molecular formula C12H10N8O2 and a molecular weight of 298.27 g/mol. Its IUPAC name is 1-(3-amino-5-hydroxy-1,2,4-benzotriazin-7-yl)-3-pyrazin-2-ylurea.
| Compound Name | 1-(3-amino-5-hydroxy-1,2,4-benzotriazin-7-yl)-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 136658805 |
| Molecular Formula | C12H10N8O2 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(3-amino-5-hydroxy-1,2,4-benzotriazin-7-yl)-3-pyrazin-2-ylurea |
| SMILES | Nc1nnc2cc(NC(=O)Nc3cnccn3)cc(O)c2n1 |
| InChI | InChI=1S/C12H10N8O2/c13-11-18-10-7(19-20-11)3-6(4-8(10)21)16-12(22)17-9-5-14-1-2-15-9/h1-5,21H,(H2,13,18,20)(H2,15,16,17,22) |
| InChIKey | IMTBCVOAYRBWMD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |