C12H10N4O4 — CID 110492352
2-hydroxy-4-(pyrazin-2-ylcarbamoylamino)benzoic acid (PubChem CID 110492352) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-hydroxy-4-(pyrazin-2-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-hydroxy-4-(pyrazin-2-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 110492352 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-hydroxy-4-(pyrazin-2-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(O)c1)Nc1cnccn1 |
| InChI | InChI=1S/C12H10N4O4/c17-9-5-7(1-2-8(9)11(18)19)15-12(20)16-10-6-13-3-4-14-10/h1-6,17H,(H,18,19)(H2,14,15,16,20) |
| InChIKey | OHECKTHZJIKZLM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |