C42H58N4O2 — CID 69312721
N,N'-bis[4-[2-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2,2-dimethylbutanediamide (PubChem CID 69312721) has the molecular formula C42H58N4O2 and a molecular weight of 650.95 g/mol. Its IUPAC name is N,N'-bis[4-[2-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2,2-dimethylbutanediamide.
| Compound Name | N,N'-bis[4-[2-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2,2-dimethylbutanediamide |
|---|---|
| PubChem CID | 69312721 |
| Molecular Formula | C42H58N4O2 |
| Molecular Weight | 650.95 g/mol |
| Exact Mass | 650.46 |
| IUPAC Name | N,N'-bis[4-[2-[(1S,8R)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl]ethyl]cyclohexyl]-2,2-dimethylbutanediamide |
| SMILES | CC(C)(CC(=O)NC1CCC(CCN2[C@@H]3CC[C@H]2c2ccccc23)CC1)C(=O)NC1CCC(CCN2[C@@H]3CC[C@H]2c2ccccc23)CC1 |
| InChI | InChI=1S/C42H58N4O2/c1-42(2,41(48)44-31-17-13-29(14-18-31)24-26-46-38-21-22-39(46)35-10-6-5-9-34(35)38)27-40(47)43-30-15-11-28(12-16-30)23-25-45-36-19-20-37(45)33-8-4-3-7-32(33)36/h3-10,28-31,36-39H,11-27H2,1-2H3,(H,43,47)(H,44,48)/t28?,29?,30?,31?,36-,37+,38-,39+ |
| InChIKey | QFAMQALHJJEFGS-RPWJNRQGSA-N |
| XLogP | 8.32 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.95 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |