C25H17FN4O — CID 69316016
N-(4-fluorophenyl)-7-methyl-2-[5-(2-pyridin-2-ylethynyl)furan-2-yl]imidazo[1,2-a]pyridin-3-amine (PubChem CID 69316016) has the molecular formula C25H17FN4O and a molecular weight of 408.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-7-methyl-2-[5-(2-pyridin-2-ylethynyl)furan-2-yl]imidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-(4-fluorophenyl)-7-methyl-2-[5-(2-pyridin-2-ylethynyl)furan-2-yl]imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 69316016 |
| Molecular Formula | C25H17FN4O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-(4-fluorophenyl)-7-methyl-2-[5-(2-pyridin-2-ylethynyl)furan-2-yl]imidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1ccn2c(Nc3ccc(F)cc3)c(-c3ccc(C#Cc4ccccn4)o3)nc2c1 |
| InChI | InChI=1S/C25H17FN4O/c1-17-13-15-30-23(16-17)29-24(25(30)28-20-7-5-18(26)6-8-20)22-12-11-21(31-22)10-9-19-4-2-3-14-27-19/h2-8,11-16,28H,1H3 |
| InChIKey | YYJGSHGSSDTJSJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_C(6)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|