C19H16N4 — CID 4535572
7-methyl-N-phenyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine (PubChem CID 4535572) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 7-methyl-N-phenyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 7-methyl-N-phenyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 4535572 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 7-methyl-N-phenyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1ccn2c(Nc3ccccc3)c(-c3ccccn3)nc2c1 |
| InChI | InChI=1S/C19H16N4/c1-14-10-12-23-17(13-14)22-18(16-9-5-6-11-20-16)19(23)21-15-7-3-2-4-8-15/h2-13,21H,1H3 |
| InChIKey | KKCCGGIHUKLFDI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_Db(5)', 'substructure': 'N/A'} |
|---|