C24H22INO5S — CID 69316273
2-[5-[4-iodo-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-2-phenylthiophen-3-yl]acetic acid (PubChem CID 69316273) has the molecular formula C24H22INO5S and a molecular weight of 563.41 g/mol. Its IUPAC name is 2-[5-[4-iodo-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-2-phenylthiophen-3-yl]acetic acid.
| Compound Name | 2-[5-[4-iodo-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-2-phenylthiophen-3-yl]acetic acid |
|---|---|
| PubChem CID | 69316273 |
| Molecular Formula | C24H22INO5S |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 563.03 |
| IUPAC Name | 2-[5-[4-iodo-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-2-phenylthiophen-3-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(=O)c2cc(CC(=O)O)c(-c3ccccc3)s2)ccc1I |
| InChI | InChI=1S/C24H22INO5S/c1-24(2,3)31-23(30)26-18-11-15(9-10-17(18)25)21(29)19-12-16(13-20(27)28)22(32-19)14-7-5-4-6-8-14/h4-12H,13H2,1-3H3,(H,26,30)(H,27,28) |
| InChIKey | HSYVHCIUGWSVAR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|