C17H11N5S — CID 69316828
2-[5-(2-pyridin-2-ylethynyl)thiophen-2-yl]imidazo[1,2-a]pyrazin-3-amine (PubChem CID 69316828) has the molecular formula C17H11N5S and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-[5-(2-pyridin-2-ylethynyl)thiophen-2-yl]imidazo[1,2-a]pyrazin-3-amine.
| Compound Name | 2-[5-(2-pyridin-2-ylethynyl)thiophen-2-yl]imidazo[1,2-a]pyrazin-3-amine |
|---|---|
| PubChem CID | 69316828 |
| Molecular Formula | C17H11N5S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[5-(2-pyridin-2-ylethynyl)thiophen-2-yl]imidazo[1,2-a]pyrazin-3-amine |
| SMILES | Nc1c(-c2ccc(C#Cc3ccccn3)s2)nc2cnccn12 |
| InChI | InChI=1S/C17H11N5S/c18-17-16(21-15-11-19-9-10-22(15)17)14-7-6-13(23-14)5-4-12-3-1-2-8-20-12/h1-3,6-11H,18H2 |
| InChIKey | WYDYGEPFCVHXKE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|