C22H22ClN5S — CID 69322338
2-[5-[2-(3-aminophenyl)ethynyl]thiophen-2-yl]-N-tert-butylimidazo[1,2-a]pyrazin-3-amine;hydrochloride (PubChem CID 69322338) has the molecular formula C22H22ClN5S and a molecular weight of 423.97 g/mol. Its IUPAC name is 2-[5-[2-(3-aminophenyl)ethynyl]thiophen-2-yl]-N-tert-butylimidazo[1,2-a]pyrazin-3-amine;hydrochloride.
| Compound Name | 2-[5-[2-(3-aminophenyl)ethynyl]thiophen-2-yl]-N-tert-butylimidazo[1,2-a]pyrazin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 69322338 |
| Molecular Formula | C22H22ClN5S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[5-[2-(3-aminophenyl)ethynyl]thiophen-2-yl]-N-tert-butylimidazo[1,2-a]pyrazin-3-amine;hydrochloride |
| SMILES | CC(C)(C)Nc1c(-c2ccc(C#Cc3cccc(N)c3)s2)nc2cnccn12.Cl |
| InChI | InChI=1S/C22H21N5S.ClH/c1-22(2,3)26-21-20(25-19-14-24-11-12-27(19)21)18-10-9-17(28-18)8-7-15-5-4-6-16(23)13-15;/h4-6,9-14,26H,23H2,1-3H3;1H |
| InChIKey | LYAOCBGTFXEKGO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|