About 1-butyl-2-iodoimidazole
1-butyl-2-iodoimidazole (PubChem CID 69317070) has the molecular formula C7H11IN2
and a molecular weight of 250.08 g/mol. Its IUPAC name is 1-butyl-2-iodoimidazole.
Molecular Properties
| Compound Name | 1-butyl-2-iodoimidazole |
| PubChem CID | 69317070 |
| Molecular Formula | C7H11IN2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-butyl-2-iodoimidazole |
| SMILES | CCCCn1ccnc1I |
| InChI | InChI=1S/C7H11IN2/c1-2-3-5-10-6-4-9-7(10)8/h4,6H,2-3,5H2,1H3 |
| InChIKey | ZAYOQEZTUQSGQF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-iodoimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-iodoimidazole?
The IUPAC name of 1-butyl-2-iodoimidazole (CID 69317070) is 1-butyl-2-iodoimidazole.
What is the SMILES notation for 1-butyl-2-iodoimidazole?
The canonical SMILES for 1-butyl-2-iodoimidazole is CCCCn1ccnc1I.
What is the InChIKey of 1-butyl-2-iodoimidazole?
The InChIKey is ZAYOQEZTUQSGQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11IN2/c1-2-3-5-10-6-4-9-7(10)8/h4,6H,2-3,5H2,1H3.
What are the key properties of 1-butyl-2-iodoimidazole?
1-butyl-2-iodoimidazole has a molecular weight of 250.08 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-iodoimidazole is sourced from PubChem (CID 69317070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).