C27H34F2N4O2 — CID 69317487
[3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 5-pyrazol-1-ylpentanoate (PubChem CID 69317487) has the molecular formula C27H34F2N4O2 and a molecular weight of 484.59 g/mol. Its IUPAC name is [3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 5-pyrazol-1-ylpentanoate.
| Compound Name | [3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 5-pyrazol-1-ylpentanoate |
|---|---|
| PubChem CID | 69317487 |
| Molecular Formula | C27H34F2N4O2 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | [3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 5-pyrazol-1-ylpentanoate |
| SMILES | CCc1cccc(CNCC(OC(=O)CCCCn2cccn2)C(N)Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C27H34F2N4O2/c1-2-20-7-5-8-21(13-20)18-31-19-26(25(30)16-22-14-23(28)17-24(29)15-22)35-27(34)9-3-4-11-33-12-6-10-32-33/h5-8,10,12-15,17,25-26,31H,2-4,9,11,16,18-19,30H2,1H3 |
| InChIKey | NHXZKHFRMGUEEH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|