C24H33F2N3O4S — CID 69320776
[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 4-(methanesulfonamido)butanoate (PubChem CID 69320776) has the molecular formula C24H33F2N3O4S and a molecular weight of 497.61 g/mol. Its IUPAC name is [(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 4-(methanesulfonamido)butanoate.
| Compound Name | [(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 4-(methanesulfonamido)butanoate |
|---|---|
| PubChem CID | 69320776 |
| Molecular Formula | C24H33F2N3O4S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | [(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[(3-ethylphenyl)methylamino]butan-2-yl] 4-(methanesulfonamido)butanoate |
| SMILES | CCc1cccc(CNC[C@@H](OC(=O)CCCNS(C)(=O)=O)[C@@H](N)Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C24H33F2N3O4S/c1-3-17-6-4-7-18(10-17)15-28-16-23(33-24(30)8-5-9-29-34(2,31)32)22(27)13-19-11-20(25)14-21(26)12-19/h4,6-7,10-12,14,22-23,28-29H,3,5,8-9,13,15-16,27H2,1-2H3/t22-,23+/m0/s1 |
| InChIKey | GCPZUCHEKRKHLQ-XZOQPEGZSA-N |
| XLogP | 2.43 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|