C20H17ClN2OS — CID 69318824
1-(1,3-benzothiazol-2-yl)-4-[2-(3-chlorophenyl)ethynyl]piperidin-4-ol (PubChem CID 69318824) has the molecular formula C20H17ClN2OS and a molecular weight of 368.89 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-4-[2-(3-chlorophenyl)ethynyl]piperidin-4-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-4-[2-(3-chlorophenyl)ethynyl]piperidin-4-ol |
|---|---|
| PubChem CID | 69318824 |
| Molecular Formula | C20H17ClN2OS |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-4-[2-(3-chlorophenyl)ethynyl]piperidin-4-ol |
| SMILES | OC1(C#Cc2cccc(Cl)c2)CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C20H17ClN2OS/c21-16-5-3-4-15(14-16)8-9-20(24)10-12-23(13-11-20)19-22-17-6-1-2-7-18(17)25-19/h1-7,14,24H,10-13H2 |
| InChIKey | NXAFKWZYFOCBCQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|