C31H39F2N5O3S — CID 69320373
N'-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[5-(cyclopentylmethyl)-1,3,4-thiadiazol-2-yl]-N'-[(3-ethylphenyl)methyl]butanediamide (PubChem CID 69320373) has the molecular formula C31H39F2N5O3S and a molecular weight of 599.75 g/mol. Its IUPAC name is N'-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[5-(cyclopentylmethyl)-1,3,4-thiadiazol-2-yl]-N'-[(3-ethylphenyl)methyl]butanediamide.
| Compound Name | N'-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[5-(cyclopentylmethyl)-1,3,4-thiadiazol-2-yl]-N'-[(3-ethylphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 69320373 |
| Molecular Formula | C31H39F2N5O3S |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | N'-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[5-(cyclopentylmethyl)-1,3,4-thiadiazol-2-yl]-N'-[(3-ethylphenyl)methyl]butanediamide |
| SMILES | CCc1cccc(CN(C[C@@H](O)[C@@H](N)Cc2cc(F)cc(F)c2)C(=O)CCC(=O)Nc2nnc(CC3CCCC3)s2)c1 |
| InChI | InChI=1S/C31H39F2N5O3S/c1-2-20-8-5-9-22(12-20)18-38(19-27(39)26(34)15-23-13-24(32)17-25(33)14-23)30(41)11-10-28(40)35-31-37-36-29(42-31)16-21-6-3-4-7-21/h5,8-9,12-14,17,21,26-27,39H,2-4,6-7,10-11,15-16,18-19,34H2,1H3,(H,35,37,40)/t26-,27+/m0/s1 |
| InChIKey | ZQFFHAXRWSNDQO-RRPNLBNLSA-N |
| XLogP | 4.79 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |