C23H24Cl2N4O5S — CID 69320656
2-[4-[[[5-[(2,6-dichlorophenyl)sulfonylmethylamino]-2-oxopent-3-enyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid (PubChem CID 69320656) has the molecular formula C23H24Cl2N4O5S and a molecular weight of 539.44 g/mol. Its IUPAC name is 2-[4-[[[5-[(2,6-dichlorophenyl)sulfonylmethylamino]-2-oxopent-3-enyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid.
| Compound Name | 2-[4-[[[5-[(2,6-dichlorophenyl)sulfonylmethylamino]-2-oxopent-3-enyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid |
|---|---|
| PubChem CID | 69320656 |
| Molecular Formula | C23H24Cl2N4O5S |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 2-[4-[[[5-[(2,6-dichlorophenyl)sulfonylmethylamino]-2-oxopent-3-enyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylic acid |
| SMILES | O=C(C=CCNCS(=O)(=O)c1c(Cl)cccc1Cl)CNCc1ccc(C2=NCCN2C(=O)O)cc1 |
| InChI | InChI=1S/C23H24Cl2N4O5S/c24-19-4-1-5-20(25)21(19)35(33,34)15-26-10-2-3-18(30)14-27-13-16-6-8-17(9-7-16)22-28-11-12-29(22)23(31)32/h1-9,26-27H,10-15H2,(H,31,32) |
| InChIKey | JSBZMXZABNWCLU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|