C19H27ClN2O5S — CID 69320690
3-heptan-4-ylsulfonyl-2-(1H-indole-6-carbonylamino)propanoic acid;hydrochloride (PubChem CID 69320690) has the molecular formula C19H27ClN2O5S and a molecular weight of 430.95 g/mol. Its IUPAC name is 3-heptan-4-ylsulfonyl-2-(1H-indole-6-carbonylamino)propanoic acid;hydrochloride.
| Compound Name | 3-heptan-4-ylsulfonyl-2-(1H-indole-6-carbonylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 69320690 |
| Molecular Formula | C19H27ClN2O5S |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-heptan-4-ylsulfonyl-2-(1H-indole-6-carbonylamino)propanoic acid;hydrochloride |
| SMILES | CCCC(CCC)S(=O)(=O)CC(NC(=O)c1ccc2cc[nH]c2c1)C(=O)O.Cl |
| InChI | InChI=1S/C19H26N2O5S.ClH/c1-3-5-15(6-4-2)27(25,26)12-17(19(23)24)21-18(22)14-8-7-13-9-10-20-16(13)11-14;/h7-11,15,17,20H,3-6,12H2,1-2H3,(H,21,22)(H,23,24);1H |
| InChIKey | ICRWFZVGJFTKAE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |