C24H39N3O5P+ — CID 69321354
[(3R)-4-[[(2S)-2-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methyl]butanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium (PubChem CID 69321354) has the molecular formula C24H39N3O5P+ and a molecular weight of 480.57 g/mol. Its IUPAC name is [(3R)-4-[[(2S)-2-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methyl]butanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium.
| Compound Name | [(3R)-4-[[(2S)-2-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methyl]butanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69321354 |
| Molecular Formula | C24H39N3O5P+ |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | [(3R)-4-[[(2S)-2-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methyl]butanoyl]amino]-1-cyclohexyl-3-hydroxybutyl]-hydroxy-oxophosphanium |
| SMILES | CC[C@@H](CNC(=O)[C@@H](N)Cc1ccccc1)C(=O)NC[C@H](O)CC(C1CCCCC1)[P+](=O)O |
| InChI | InChI=1S/C24H38N3O5P/c1-2-18(15-26-24(30)21(25)13-17-9-5-3-6-10-17)23(29)27-16-20(28)14-22(33(31)32)19-11-7-4-8-12-19/h3,5-6,9-10,18-22,28H,2,4,7-8,11-16,25H2,1H3,(H2-,26,27,29,30,31,32)/p+1/t18-,20+,21-,22?/m0/s1 |
| InChIKey | NCPPVBPWRIHXOL-LULQAZMYSA-O |
| XLogP | 2.25 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|