C21H20FN5O2 — CID 69323273
(6-fluoro-3-pyridinyl)-[3-[5-(1H-indol-2-yl)-2H-oxadiazol-3-yl]piperidin-1-yl]methanone (PubChem CID 69323273) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is (6-fluoro-3-pyridinyl)-[3-[5-(1H-indol-2-yl)-2H-oxadiazol-3-yl]piperidin-1-yl]methanone.
| Compound Name | (6-fluoro-3-pyridinyl)-[3-[5-(1H-indol-2-yl)-2H-oxadiazol-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 69323273 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (6-fluoro-3-pyridinyl)-[3-[5-(1H-indol-2-yl)-2H-oxadiazol-3-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)nc1)N1CCCC(N2C=C(c3cc4ccccc4[nH]3)ON2)C1 |
| InChI | InChI=1S/C21H20FN5O2/c22-20-8-7-15(11-23-20)21(28)26-9-3-5-16(12-26)27-13-19(29-25-27)18-10-14-4-1-2-6-17(14)24-18/h1-2,4,6-8,10-11,13,16,24-25H,3,5,9,12H2 |
| InChIKey | JFJIFONKXJPVNW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|