C15H20O4S — CID 69325060
2-(2-carboxyethylsulfanylmethyl)-3-(2,3-dimethylphenyl)propanoic acid (PubChem CID 69325060) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-(2-carboxyethylsulfanylmethyl)-3-(2,3-dimethylphenyl)propanoic acid.
| Compound Name | 2-(2-carboxyethylsulfanylmethyl)-3-(2,3-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 69325060 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-(2-carboxyethylsulfanylmethyl)-3-(2,3-dimethylphenyl)propanoic acid |
| SMILES | Cc1cccc(CC(CSCCC(=O)O)C(=O)O)c1C |
| InChI | InChI=1S/C15H20O4S/c1-10-4-3-5-12(11(10)2)8-13(15(18)19)9-20-7-6-14(16)17/h3-5,13H,6-9H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | CHBKEFFAFAFRJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|