C35H44ClN3O — CID 69325706
4-tert-butyl-2-[[butyl-[[3-butyl-5-(4-chlorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol (PubChem CID 69325706) has the molecular formula C35H44ClN3O and a molecular weight of 558.21 g/mol. Its IUPAC name is 4-tert-butyl-2-[[butyl-[[3-butyl-5-(4-chlorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol.
| Compound Name | 4-tert-butyl-2-[[butyl-[[3-butyl-5-(4-chlorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 69325706 |
| Molecular Formula | C35H44ClN3O |
| Molecular Weight | 558.21 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | 4-tert-butyl-2-[[butyl-[[3-butyl-5-(4-chlorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol |
| SMILES | CCCCN(Cc1cc(C(C)(C)C)ccc1O)Cc1c(-c2ccc(Cl)cc2)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C35H44ClN3O/c1-6-8-21-38(24-28-23-29(35(3,4)5)17-20-32(28)40)25-31-33(26-15-18-30(36)19-16-26)37-34(39(31)22-9-7-2)27-13-11-10-12-14-27/h10-20,23,40H,6-9,21-22,24-25H2,1-5H3 |
| InChIKey | PDOVZLAIELGPTA-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.21 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|