C32H37Cl2N3 — CID 69326705
N-[(2,6-dichlorophenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine (PubChem CID 69326705) has the molecular formula C32H37Cl2N3 and a molecular weight of 534.58 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 69326705 |
| Molecular Formula | C32H37Cl2N3 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine |
| SMILES | CCCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CN(CCCC)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C32H37Cl2N3/c1-3-5-13-22-37-30(24-36(21-6-4-2)23-27-28(33)19-14-20-29(27)34)31(25-15-9-7-10-16-25)35-32(37)26-17-11-8-12-18-26/h7-12,14-20H,3-6,13,21-24H2,1-2H3 |
| InChIKey | YIFBCCRQUORVGT-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|