C35H45N3O2 — CID 69327466
N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine (PubChem CID 69327466) has the molecular formula C35H45N3O2 and a molecular weight of 539.76 g/mol. Its IUPAC name is N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine.
| Compound Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 69327466 |
| Molecular Formula | C35H45N3O2 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]butan-1-amine |
| SMILES | CCCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CN(CCCC)Cc1ccc(OC)c(C)c1OC |
| InChI | InChI=1S/C35H45N3O2/c1-6-8-16-24-38-31(33(28-17-12-10-13-18-28)36-35(38)29-19-14-11-15-20-29)26-37(23-9-7-2)25-30-21-22-32(39-4)27(3)34(30)40-5/h10-15,17-22H,6-9,16,23-26H2,1-5H3 |
| InChIKey | UBLJDSBZWSJRRP-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|