C33H40BrN3O2 — CID 69302473
4-bromo-2-[[butyl-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-6-methoxyphenol (PubChem CID 69302473) has the molecular formula C33H40BrN3O2 and a molecular weight of 590.61 g/mol. Its IUPAC name is 4-bromo-2-[[butyl-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-6-methoxyphenol.
| Compound Name | 4-bromo-2-[[butyl-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 69302473 |
| Molecular Formula | C33H40BrN3O2 |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 4-bromo-2-[[butyl-[(3-pentyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-6-methoxyphenol |
| SMILES | CCCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CN(CCCC)Cc1cc(Br)cc(OC)c1O |
| InChI | InChI=1S/C33H40BrN3O2/c1-4-6-14-20-37-29(24-36(19-7-5-2)23-27-21-28(34)22-30(39-3)32(27)38)31(25-15-10-8-11-16-25)35-33(37)26-17-12-9-13-18-26/h8-13,15-18,21-22,38H,4-7,14,19-20,23-24H2,1-3H3 |
| InChIKey | GTLTXNSOOXQJQK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|