C7H16N2S — CID 6932629
(3S)-3-(aminomethyl)-N,N-dimethylthiolan-3-amine (PubChem CID 6932629) has the molecular formula C7H16N2S and a molecular weight of 160.29 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-N,N-dimethylthiolan-3-amine.
| Compound Name | (3S)-3-(aminomethyl)-N,N-dimethylthiolan-3-amine |
|---|---|
| PubChem CID | 6932629 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (3S)-3-(aminomethyl)-N,N-dimethylthiolan-3-amine |
| SMILES | CN(C)[C@]1(CN)CCSC1 |
| InChI | InChI=1S/C7H16N2S/c1-9(2)7(5-8)3-4-10-6-7/h3-6,8H2,1-2H3/t7-/m0/s1 |
| InChIKey | QSPJOBDYLWKZPW-ZETCQYMHSA-N |
| XLogP | 0.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |