C7H16N2OS — CID 67060899
3-(aminomethyl)-N,N-dimethyl-1-oxothiolan-3-amine (PubChem CID 67060899) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dimethyl-1-oxothiolan-3-amine.
| Compound Name | 3-(aminomethyl)-N,N-dimethyl-1-oxothiolan-3-amine |
|---|---|
| PubChem CID | 67060899 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3-(aminomethyl)-N,N-dimethyl-1-oxothiolan-3-amine |
| SMILES | CN(C)C1(CN)CCS(=O)C1 |
| InChI | InChI=1S/C7H16N2OS/c1-9(2)7(5-8)3-4-11(10)6-7/h3-6,8H2,1-2H3 |
| InChIKey | QDTIJCKKVMRXNU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |