C10H12N2O3 — CID 69328399
2-[(2-aminoacetyl)amino]-3-methylbenzoic acid (PubChem CID 69328399) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-3-methylbenzoic acid.
| Compound Name | 2-[(2-aminoacetyl)amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 69328399 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1NC(=O)CN |
| InChI | InChI=1S/C10H12N2O3/c1-6-3-2-4-7(10(14)15)9(6)12-8(13)5-11/h2-4H,5,11H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | WQRVPRAVEXWRTP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |