C10H15ClN2O — CID 162641599
2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide;hydrochloride (PubChem CID 162641599) has the molecular formula C10H15ClN2O and a molecular weight of 220.73 g/mol. Its IUPAC name is 2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 162641599 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 220.73 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1NC(=O)CN |
| InChI | InChI=1S/C10H14N2O.ClH/c1-7-4-3-5-8(2)10(7)12-9(13)6-11;/h3-5H,6,11H2,1-2H3,(H,12,13);1H/i1D3,2D3; |
| InChIKey | HPVGPNNVMZBKIB-TXHXQZCNSA-N |
| XLogP | 1.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |