About (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione
(3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione (PubChem CID 6933020) has the molecular formula C15H8Cl2FNO2
and a molecular weight of 324.14 g/mol. Its IUPAC name is (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione.
Molecular Properties
| Compound Name | (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione |
| PubChem CID | 6933020 |
| Molecular Formula | C15H8Cl2FNO2 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione |
| SMILES | O=C1Nc2cc(Cl)c(Cl)cc2C(=O)[C@]1(F)c1ccccc1 |
| InChI | InChI=1S/C15H8Cl2FNO2/c16-10-6-9-12(7-11(10)17)19-14(21)15(18,13(9)20)8-4-2-1-3-5-8/h1-7H,(H,19,21)/t15-/m1/s1 |
| InChIKey | BVQZTGMWOCVHPR-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione?
The IUPAC name of (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione (CID 6933020) is (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione.
What is the SMILES notation for (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione?
The canonical SMILES for (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione is O=C1Nc2cc(Cl)c(Cl)cc2C(=O)[C@]1(F)c1ccccc1.
What is the InChIKey of (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione?
The InChIKey is BVQZTGMWOCVHPR-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H8Cl2FNO2/c16-10-6-9-12(7-11(10)17)19-14(21)15(18,13(9)20)8-4-2-1-3-5-8/h1-7H,(H,19,21)/t15-/m1/s1.
What are the key properties of (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione?
(3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione has a molecular weight of 324.14 g/mol, XLogP of 3.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6,7-dichloro-3-fluoro-3-phenyl-1H-quinoline-2,4-dione is sourced from PubChem (CID 6933020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).