About 2H-thieno[2,3-b]pyrrole
2H-thieno[2,3-b]pyrrole (PubChem CID 69330287) has the molecular formula C6H5NS
and a molecular weight of 123.18 g/mol. Its IUPAC name is 2H-thieno[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 2H-thieno[2,3-b]pyrrole |
| PubChem CID | 69330287 |
| Molecular Formula | C6H5NS |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | 2H-thieno[2,3-b]pyrrole |
| SMILES | C1=CC2=CCSC2=N1 |
| InChI | InChI=1S/C6H5NS/c1-3-7-6-5(1)2-4-8-6/h1-3H,4H2 |
| InChIKey | BZKNIRBUIHTRQG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-thieno[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-thieno[2,3-b]pyrrole?
The IUPAC name of 2H-thieno[2,3-b]pyrrole (CID 69330287) is 2H-thieno[2,3-b]pyrrole.
What is the SMILES notation for 2H-thieno[2,3-b]pyrrole?
The canonical SMILES for 2H-thieno[2,3-b]pyrrole is C1=CC2=CCSC2=N1.
What is the InChIKey of 2H-thieno[2,3-b]pyrrole?
The InChIKey is BZKNIRBUIHTRQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS/c1-3-7-6-5(1)2-4-8-6/h1-3H,4H2.
What are the key properties of 2H-thieno[2,3-b]pyrrole?
2H-thieno[2,3-b]pyrrole has a molecular weight of 123.18 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-thieno[2,3-b]pyrrole is sourced from PubChem (CID 69330287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).