C36H32N4O7S — CID 69331157
N-(benzenesulfonyl)-2-[[1-(1,3-dioxoisoindol-2-yl)isoquinolin-6-yl]amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide (PubChem CID 69331157) has the molecular formula C36H32N4O7S and a molecular weight of 664.74 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-[[1-(1,3-dioxoisoindol-2-yl)isoquinolin-6-yl]amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide.
| Compound Name | N-(benzenesulfonyl)-2-[[1-(1,3-dioxoisoindol-2-yl)isoquinolin-6-yl]amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 69331157 |
| Molecular Formula | C36H32N4O7S |
| Molecular Weight | 664.74 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | N-(benzenesulfonyl)-2-[[1-(1,3-dioxoisoindol-2-yl)isoquinolin-6-yl]amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)acetamide |
| SMILES | CCOc1cc(C(Nc2ccc3c(N4C(=O)c5ccccc5C4=O)nccc3c2)C(=O)NS(=O)(=O)c2ccccc2)ccc1OC(C)C |
| InChI | InChI=1S/C36H32N4O7S/c1-4-46-31-21-24(14-17-30(31)47-22(2)3)32(34(41)39-48(44,45)26-10-6-5-7-11-26)38-25-15-16-27-23(20-25)18-19-37-33(27)40-35(42)28-12-8-9-13-29(28)36(40)43/h5-22,32,38H,4H2,1-3H3,(H,39,41) |
| InChIKey | CBRGHAYNXXLSOX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|