C21H19N7O — CID 69331931
6-[5-amino-3-phenyl-6-(pyridin-2-ylmethylamino)pyrazin-2-yl]-2-methylpyridazin-3-one (PubChem CID 69331931) has the molecular formula C21H19N7O and a molecular weight of 385.43 g/mol. Its IUPAC name is 6-[5-amino-3-phenyl-6-(pyridin-2-ylmethylamino)pyrazin-2-yl]-2-methylpyridazin-3-one.
| Compound Name | 6-[5-amino-3-phenyl-6-(pyridin-2-ylmethylamino)pyrazin-2-yl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 69331931 |
| Molecular Formula | C21H19N7O |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 6-[5-amino-3-phenyl-6-(pyridin-2-ylmethylamino)pyrazin-2-yl]-2-methylpyridazin-3-one |
| SMILES | Cn1nc(-c2nc(NCc3ccccn3)c(N)nc2-c2ccccc2)ccc1=O |
| InChI | InChI=1S/C21H19N7O/c1-28-17(29)11-10-16(27-28)19-18(14-7-3-2-4-8-14)25-20(22)21(26-19)24-13-15-9-5-6-12-23-15/h2-12H,13H2,1H3,(H2,22,25)(H,24,26) |
| InChIKey | MZHCRBOAVVWUBN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |