C22H32N2O6 — CID 69334475
tert-butyl 3-(3-hydroxy-2-nitro-3-phenylpropyl)-7-(methoxymethyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 69334475) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl 3-(3-hydroxy-2-nitro-3-phenylpropyl)-7-(methoxymethyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 3-(3-hydroxy-2-nitro-3-phenylpropyl)-7-(methoxymethyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 69334475 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | tert-butyl 3-(3-hydroxy-2-nitro-3-phenylpropyl)-7-(methoxymethyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COCC1C2CCC1N(C(=O)OC(C)(C)C)C2CC(C(O)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C22H32N2O6/c1-22(2,3)30-21(26)23-17-11-10-15(16(17)13-29-4)18(23)12-19(24(27)28)20(25)14-8-6-5-7-9-14/h5-9,15-20,25H,10-13H2,1-4H3 |
| InChIKey | QRUXWBXTVCYBDT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|