C19H25NO6 — CID 101373630
tert-butyl (2R)-6-hydroxy-2-[(R)-methoxymethoxy(phenyl)methyl]-3-oxo-2,6-dihydropyridine-1-carboxylate (PubChem CID 101373630) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl (2R)-6-hydroxy-2-[(R)-methoxymethoxy(phenyl)methyl]-3-oxo-2,6-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl (2R)-6-hydroxy-2-[(R)-methoxymethoxy(phenyl)methyl]-3-oxo-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 101373630 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | tert-butyl (2R)-6-hydroxy-2-[(R)-methoxymethoxy(phenyl)methyl]-3-oxo-2,6-dihydropyridine-1-carboxylate |
| SMILES | COCO[C@H](c1ccccc1)[C@@H]1C(=O)C=CC(O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25NO6/c1-19(2,3)26-18(23)20-15(22)11-10-14(21)16(20)17(25-12-24-4)13-8-6-5-7-9-13/h5-11,15-17,22H,12H2,1-4H3/t15?,16-,17+/m0/s1 |
| InChIKey | GABQMUVHPITORW-LRUHZDSUSA-N |
| XLogP | 2.41 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|