C15H24O2 — CID 69335250
methyl 3,3-dicyclopentyl-2-methylprop-2-enoate (PubChem CID 69335250) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is methyl 3,3-dicyclopentyl-2-methylprop-2-enoate.
| Compound Name | methyl 3,3-dicyclopentyl-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 69335250 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | methyl 3,3-dicyclopentyl-2-methylprop-2-enoate |
| SMILES | COC(=O)C(C)=C(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C15H24O2/c1-11(15(16)17-2)14(12-7-3-4-8-12)13-9-5-6-10-13/h12-13H,3-10H2,1-2H3 |
| InChIKey | JALKVLNSPBUBII-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|