C15H22N2O2S — CID 69335858
methyl 3-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-5-yl]propanoate (PubChem CID 69335858) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is methyl 3-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-5-yl]propanoate.
| Compound Name | methyl 3-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 69335858 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | methyl 3-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-5-yl]propanoate |
| SMILES | COC(=O)CCc1cnc(N2CCC3CCCCC32)s1 |
| InChI | InChI=1S/C15H22N2O2S/c1-19-14(18)7-6-12-10-16-15(20-12)17-9-8-11-4-2-3-5-13(11)17/h10-11,13H,2-9H2,1H3 |
| InChIKey | YNXLGODEHISOBA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |