C11H17N3S — CID 133354542
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methyl-1,3,4-thiadiazole (PubChem CID 133354542) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 133354542 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(N2CCC3CCCCC32)s1 |
| InChI | InChI=1S/C11H17N3S/c1-8-12-13-11(15-8)14-7-6-9-4-2-3-5-10(9)14/h9-10H,2-7H2,1H3 |
| InChIKey | FGMFWUWVQBSIAJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |